cas: 199391-70-3 — see every product listed under this CAS number, including other names
5–Fluorobenzofuran–4–carbaldehyde (CAS 199391-70-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF21376-100mg |
| cas | 199391-70-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 578.32 Pln | |
| GLPBio | 1g | 1467.61 Pln | |
| GLPBio | 250mg | 793.62 Pln | |
| GLPBio | 5g | 4065.29 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-fluoro-1-benzofuran-4-carbaldehyde (CAS 199391-70-3) is a chemical compound with the molecular formula C9H5FO2 and a molecular weight of 164.13 g/mol. IUPAC name: 5-fluoro-1-benzofuran-4-carbaldehyde. InChIKey: KVZVZQXBAPJNPX-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2 |
|---|---|
| Molecular weight | 164.13 g/mol |
| IUPAC name | 5-fluoro-1-benzofuran-4-carbaldehyde |
| InChIKey | KVZVZQXBAPJNPX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1OC=C2)C=O)F |
Computed by PubChem (NCBI)