Products 705-83-9
CAS 705-83-9 appears in our catalog under these names: 3-(3-Fluorophenyl)prop-2-ynoic acid, 95%, 3–(3–Fluorophenyl)prop–2–ynoic acid, 3-(3-fluorophenyl)prop-2-ynoic acid, 3-(3-Fluorophenyl)propiolic acid 95%, 3-(3-Fluorophenyl)prop-2-ynoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 2.5g, 10g.
3-(3-fluorophenyl)prop-2-ynoic acid (CAS 705-83-9) is a chemical compound with the molecular formula C9H5FO2 and a molecular weight of 164.13 g/mol. IUPAC name: 3-(3-fluorophenyl)prop-2-ynoic acid. InChIKey: NNOYZYGSKUOROV-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2 |
|---|---|
| Molecular weight | 164.13 g/mol |
| IUPAC name | 3-(3-fluorophenyl)prop-2-ynoic acid |
| InChIKey | NNOYZYGSKUOROV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C#CC(=O)O |
Computed by PubChem (NCBI)