Products 736117-41-2
CAS 736117-41-2 appears in our catalog under these names: 4–Ethynyl–2–fluorobenzoic acid, 4-Ethynyl-2-fluorobenzoic acid, 95%, 4-Ethynyl-2-fluorobenzoic acid, 98%, 4-Ethynyl-2-fluorobenzoic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
4-ethynyl-2-fluorobenzoic acid (CAS 736117-41-2) is a chemical compound with the molecular formula C9H5FO2 and a molecular weight of 164.13 g/mol. IUPAC name: 4-ethynyl-2-fluorobenzoic acid. InChIKey: OKFQFYAGCCDDEH-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2 |
|---|---|
| Molecular weight | 164.13 g/mol |
| IUPAC name | 4-ethynyl-2-fluorobenzoic acid |
| InChIKey | OKFQFYAGCCDDEH-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)