Products 1862427-77-7
CAS 1862427-77-7 appears in our catalog under these names: 4-Ethynyl-3-fluorobenzoic acid, 95%, 4-Ethynyl-3-fluorobenzoic acid, 97%, 4-Ethynyl-3-fluorobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg.
4-ethynyl-3-fluorobenzoic acid (CAS 1862427-77-7) is a chemical compound with the molecular formula C9H5FO2 and a molecular weight of 164.13 g/mol. IUPAC name: 4-ethynyl-3-fluorobenzoic acid. InChIKey: JAUFNXVOUWCYNW-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2 |
|---|---|
| Molecular weight | 164.13 g/mol |
| IUPAC name | 4-ethynyl-3-fluorobenzoic acid |
| InChIKey | JAUFNXVOUWCYNW-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)