CAS 2305799-99-7 is the registry number for 6-Fluoro-1H-indene-1,2(3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-3H-indene-1,2-dione (CAS 2305799-99-7) is a chemical compound with the molecular formula C9H5FO2 and a molecular weight of 164.13 g/mol. IUPAC name: 6-fluoro-3H-indene-1,2-dione. InChIKey: HPIGQUNMZSVSLQ-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2 |
|---|---|
| Molecular weight | 164.13 g/mol |
| IUPAC name | 6-fluoro-3H-indene-1,2-dione |
| InChIKey | HPIGQUNMZSVSLQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)F)C(=O)C1=O |
Computed by PubChem (NCBI)