cas: 39181-40-3 — see every product listed under this CAS number, including other names
5-(2-Phenylethyl)-1,3,4-thiadiazol-2-amine, 98%, 98% (CAS 39181-40-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11873D-100mg |
| cas | 39181-40-3 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 1840.40 Pln | |
| Chemat | 10g | 3002.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-(2-phenylethyl)-1,3,4-thiadiazol-2-amine is an aromatic amine and a member of thiadiazoles.
Source: ChEBI
| Molecular formula | C10H11N3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 5-(2-phenylethyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | HSTFNSVDVOLQQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=NN=C(S2)N |
Computed by PubChem (NCBI)