cas: 2379322-63-9 — see every product listed under this CAS number, including other names
5-(3-(Benzyloxy)-4-methylphenyl)oxazole (CAS 2379322-63-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632803-1G |
| cas | 2379322-63-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 8692.79 Pln | |
| Fluorochem | 5g | 25941.92 Pln |
| delivery time | 3-4 weeks |
|---|
5-(4-methyl-3-phenylmethoxyphenyl)-1,3-oxazole (CAS 2379322-63-9) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: 5-(4-methyl-3-phenylmethoxyphenyl)-1,3-oxazole. InChIKey: ZVKPWIZEGBPEFL-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 5-(4-methyl-3-phenylmethoxyphenyl)-1,3-oxazole |
| InChIKey | ZVKPWIZEGBPEFL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CN=CO2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)