cas: 191602-85-4 — see every product listed under this CAS number, including other names
5-(3-Bromo-4-isopropoxyphenyl)oxazole (CAS 191602-85-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630488-1G |
| cas | 191602-85-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4824.36 Pln | |
| Fluorochem | 5g | 14347.05 Pln |
| delivery time | 3-4 weeks |
|---|
5-(3-bromo-4-propan-2-yloxyphenyl)-1,3-oxazole (CAS 191602-85-4) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 5-(3-bromo-4-propan-2-yloxyphenyl)-1,3-oxazole. InChIKey: KCKJEJOHYCJAPU-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 5-(3-bromo-4-propan-2-yloxyphenyl)-1,3-oxazole |
| InChIKey | KCKJEJOHYCJAPU-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C2=CN=CO2)Br |
Computed by PubChem (NCBI)