Products 1513498-15-1
CAS 1513498-15-1 is the registry number for 2-(5-Bromo-1h-indol-3-yl)-2-methyl-propionic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(5-bromo-1H-indol-3-yl)-2-methylpropanoic acid (CAS 1513498-15-1) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 2-(5-bromo-1H-indol-3-yl)-2-methylpropanoic acid. InChIKey: WRNKZSXGGRQWCI-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 2-(5-bromo-1H-indol-3-yl)-2-methylpropanoic acid |
| InChIKey | WRNKZSXGGRQWCI-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CNC2=C1C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)