CAS 1694132-58-5 appears in our catalog under these names: 7-Bromo-1h-spiro[indole-3,4'-oxane]-2-one, 95%, 7-Bromo-2',3',5',6'-tetrahydrospiro(indoline-3,4'-pyran)-2-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
7-bromospiro[1H-indole-3,4'-oxane]-2-one (CAS 1694132-58-5) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 7-bromospiro[1H-indole-3,4'-oxane]-2-one. InChIKey: QGABJZKATUVAQY-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 7-bromospiro[1H-indole-3,4'-oxane]-2-one |
| InChIKey | QGABJZKATUVAQY-UHFFFAOYSA-N |
| SMILES | C1COCCC12C3=C(C(=CC=C3)Br)NC2=O |
Computed by PubChem (NCBI)