CAS 1190861-43-8 appears in our catalog under these names: 6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one, 95%, 6-Bromo-2',3',5',6'-tetrahydrospiro(indoline-3,4'-pyran)-2-one, 6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one, 98%, 98%, 6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 0,5g, 2.5g.
6-bromospiro[1H-indole-3,4'-oxane]-2-one (CAS 1190861-43-8) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 6-bromospiro[1H-indole-3,4'-oxane]-2-one. InChIKey: WGDOZEMHDIATQE-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 6-bromospiro[1H-indole-3,4'-oxane]-2-one |
| InChIKey | WGDOZEMHDIATQE-UHFFFAOYSA-N |
| SMILES | C1COCCC12C3=C(C=C(C=C3)Br)NC2=O |
Computed by PubChem (NCBI)