Products 2227272-50-4
CAS 2227272-50-4 is the registry number for 5-Bromo-2-(tetrahydrofuran-3-yl)isoindolin-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
5-bromo-2-(oxolan-3-yl)-3H-isoindol-1-one (CAS 2227272-50-4) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 5-bromo-2-(oxolan-3-yl)-3H-isoindol-1-one. InChIKey: HGNQCSVHCAGAAD-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 5-bromo-2-(oxolan-3-yl)-3H-isoindol-1-one |
| InChIKey | HGNQCSVHCAGAAD-UHFFFAOYSA-N |
| SMILES | C1COCC1N2CC3=C(C2=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)