cas: 956360-07-9 — see every product listed under this CAS number, including other names
5-(3-Cyanophenyl)isoxazole-3-carboxylic acid (CAS 956360-07-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447379-100MG |
| cas | 956360-07-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 857.01 Pln | |
| Fluorochem | 250mg | 1226.67 Pln | |
| Fluorochem | 1g | 3017.71 Pln | |
| Fluorochem | 5g | 7687.94 Pln |
| delivery time | 3-4 weeks |
|---|
5-(3-cyanophenyl)-1,2-oxazole-3-carboxylic acid (CAS 956360-07-9) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 5-(3-cyanophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: WOBMZDOJEBOCCU-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O3 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 5-(3-cyanophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | WOBMZDOJEBOCCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=NO2)C(=O)O)C#N |
Computed by PubChem (NCBI)