CAS 1375064-45-1 appears in our catalog under these names: 5-(4-Cyanophenyl)isoxazole-3-carboxylic acid, 96%, 5-(4-Cyanophenyl)isoxazole-3-carboxylic acid, 95-<97%, 5-(4-Cyanophenyl)isoxazole-3-carboxylic acid, ≥97-<99%, 5–(4–Cyanophenyl)isoxazole–3–carboxylic Acid, 5-(4-Cyanophenyl)isoxazole-3-carboxylic acid 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g, 100mg.
5-(4-cyanophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1375064-45-1) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: PDHRXDLHPHLFEX-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O3 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | PDHRXDLHPHLFEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)