CAS 123457-83-0 appears in our catalog under these names: 4-(Maleinimido)phenyl isocyanate, 95%, 1-(4-Isocyanatophenyl)-1H-pyrrole-2,5-dione, 95+%, 4–(Maleinimido)phenyl isocyanate, 4-Maleimidophenyl Isocyanate, >98.0%(HPLC), p-Maleimidophenylisocyanate. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 25mg, 5mg, 0,025g, 0,05g, 0,1g.
1-(4-isocyanatophenyl)pyrrole-2,5-dione (CAS 123457-83-0) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 1-(4-isocyanatophenyl)pyrrole-2,5-dione. InChIKey: OJQSISYVGFJJBY-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O3 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 1-(4-isocyanatophenyl)pyrrole-2,5-dione |
| InChIKey | OJQSISYVGFJJBY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=O)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)