Products 1820741-37-4
CAS 1820741-37-4 appears in our catalog under these names: 6-Cyano-4-hydroxy-quinoline-2-carboxylic acid, 95%, 6-Cyano-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
6-cyano-4-oxo-1H-quinoline-2-carboxylic acid (CAS 1820741-37-4) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 6-cyano-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: WWPIHIYRDBLORM-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O3 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 6-cyano-4-oxo-1H-quinoline-2-carboxylic acid |
| InChIKey | WWPIHIYRDBLORM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=O)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)