CAS 495409-74-0 appears in our catalog under these names: 8-Cyano-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid, 95%, 8-Cyano-4-hydroxy-quinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
8-cyano-4-oxo-1H-quinoline-2-carboxylic acid (CAS 495409-74-0) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 8-cyano-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: GWGAVUZLKUMIHT-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O3 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 8-cyano-4-oxo-1H-quinoline-2-carboxylic acid |
| InChIKey | GWGAVUZLKUMIHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)C(=O)C=C(N2)C(=O)O)C#N |
Computed by PubChem (NCBI)