5-(3-Methoxyphenyl)thiophene-2-carboxylic acid, 95%
cas: 229467-25-8 — see every product listed under this CAS number, including other names
5-(3-Methoxyphenyl)thiophene-2-carboxylic acid, 95% (CAS 229467-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1077165-100mg |
| cas | 229467-25-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 609.56 Pln | |
| Ambeed | 250mg | 1076.81 Pln | |
| Ambeed | 1g | 2684.38 Pln | |
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 1912.40 Pln | |
| BLDpharm | 100mg | 653.13 Pln | |
| BLDpharm | 250mg | 1152.95 Pln | |
| BLDpharm | 1g | 2891.23 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-(3-methoxyphenyl)thiophene-2-carboxylic acid (CAS 229467-25-8) is a chemical compound with the molecular formula C12H10O3S and a molecular weight of 234.27 g/mol. IUPAC name: 5-(3-methoxyphenyl)thiophene-2-carboxylic acid. InChIKey: DEBHJSKLHXROSI-UHFFFAOYSA-N.
| Molecular formula | C12H10O3S |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)thiophene-2-carboxylic acid |
| InChIKey | DEBHJSKLHXROSI-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)
