Products 53700-79-1
CAS 53700-79-1 is the registry number for 1,2-DIhydroacenaphthylene-5-sulfonic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dihydroacenaphthylene-5-sulfonic acid (CAS 53700-79-1) is a chemical compound with the molecular formula C12H10O3S and a molecular weight of 234.27 g/mol. IUPAC name: 1,2-dihydroacenaphthylene-5-sulfonic acid. InChIKey: XXACHQRFXDSJNO-UHFFFAOYSA-N.
| Molecular formula | C12H10O3S |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylene-5-sulfonic acid |
| InChIKey | XXACHQRFXDSJNO-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=CC=CC1=C23)S(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Acenaphthylenesulfonic acid, 1,2-dihydro-, Acenaphthene-5-sulfonic acid, 1,2-dihydroacenaphthylene-5-sulfonic acid, Acenaphthene-5-sulphonic acid, 1,2-dihydro-5-Acenaphthylenesulfonic acid, 5-Acenaphthylenesulfonicacid, 1,2-dihydro-, XXACHQRFXDSJNO-UHFFFAOYSA-N, 1,2-dihydroacenaphthylene-5-sulfonicacid