Products 666841-74-3

CAS 666841-74-3 is the registry number for 3-(2-Methoxyphenyl)thiophene-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 100mg.

3-(2-methoxyphenyl)thiophene-2-carboxylic acid (CAS 666841-74-3) is a chemical compound with the molecular formula C12H10O3S and a molecular weight of 234.27 g/mol. IUPAC name: 3-(2-methoxyphenyl)thiophene-2-carboxylic acid. InChIKey: QBWDBOONGOMYNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O3S
Molecular weight234.27 g/mol
IUPAC name3-(2-methoxyphenyl)thiophene-2-carboxylic acid
InChIKeyQBWDBOONGOMYNQ-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1C2=C(SC=C2)C(=O)O

Computed by PubChem (NCBI)