cas: 39181-46-9 — see every product listed under this CAS number, including other names
5-(3-Methylbenzyl)-1,3,4-thiadiazol-2-amine 95+% (CAS 39181-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A346308-100mg |
| cas | 39181-46-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 804.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A346308 |
5-[(3-methylphenyl)methyl]-1,3,4-thiadiazol-2-amine (CAS 39181-46-9) is a chemical compound with the molecular formula C10H11N3S and a molecular weight of 205.28 g/mol. IUPAC name: 5-[(3-methylphenyl)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: PBMJDOZBOLDGHG-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 5-[(3-methylphenyl)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | PBMJDOZBOLDGHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CC2=NN=C(S2)N |
Computed by PubChem (NCBI)