cas: 1073355-14-2 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzoxadiazole, 98%, 98% (CAS 1073355-14-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WBG-100mg |
| cas | 1073355-14-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1408.40 Pln | |
| Chemat | 25g | 6266.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzoxadiazole (CAS 1073355-14-2) is a chemical compound with the molecular formula C12H15BN2O3 and a molecular weight of 246.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzoxadiazole. InChIKey: MQXANAGMQAYTMV-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O3 |
|---|---|
| Molecular weight | 246.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzoxadiazole |
| InChIKey | MQXANAGMQAYTMV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NON=C3C=C2 |
Computed by PubChem (NCBI)