cas: 1073355-14-2 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c][1,2,5]oxadiazole 98+% (CAS 1073355-14-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A260597-250mg |
| cas | 1073355-14-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1265.94 Pln | |
| Ambeed | 25g | 5515.69 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A260597 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzoxadiazole (CAS 1073355-14-2) is a chemical compound with the molecular formula C12H15BN2O3 and a molecular weight of 246.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzoxadiazole. InChIKey: MQXANAGMQAYTMV-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O3 |
|---|---|
| Molecular weight | 246.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzoxadiazole |
| InChIKey | MQXANAGMQAYTMV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NON=C3C=C2 |
Computed by PubChem (NCBI)