cas: 947249-41-4 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-amine, 95% (CAS 947249-41-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A296213-250mg |
| cas | 947249-41-4 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1277.06 Pln | |
| Ambeed | 1g | 3602.19 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3506.00 Pln | |
| BLDpharm | 100mg | 853.06 Pln | |
| BLDpharm | 250mg | 1380.65 Pln | |
| BLDpharm | 1g | 3896.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-amine (CAS 947249-41-4) is a chemical compound with the molecular formula C10H16BN3O2 and a molecular weight of 221.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-amine. InChIKey: CBNIRWXQQRNRJY-UHFFFAOYSA-N.
| Molecular formula | C10H16BN3O2 |
|---|---|
| Molecular weight | 221.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-amine |
| InChIKey | CBNIRWXQQRNRJY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=N2)N |
Computed by PubChem (NCBI)