CAS 1704073-33-5 is the registry number for (2–(4–Methylpiperidin–1–yl)pyrimidin– 5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[2-(4-methylpiperidin-1-yl)pyrimidin-5-yl]boronic acid (CAS 1704073-33-5) is a chemical compound with the molecular formula C10H16BN3O2 and a molecular weight of 221.07 g/mol. IUPAC name: [2-(4-methylpiperidin-1-yl)pyrimidin-5-yl]boronic acid. InChIKey: QALFODUIHZBJSX-UHFFFAOYSA-N.
| Molecular formula | C10H16BN3O2 |
|---|---|
| Molecular weight | 221.07 g/mol |
| IUPAC name | [2-(4-methylpiperidin-1-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | QALFODUIHZBJSX-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)N2CCC(CC2)C)(O)O |
Computed by PubChem (NCBI)