Products 2223044-20-8
CAS 2223044-20-8 is the registry number for 5–(4，4，5，5–Tetramethyl–1，3，2–dioxaborolan–2–yl)pyrimidin–4–amine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-amine (CAS 2223044-20-8) is a chemical compound with the molecular formula C10H16BN3O2 and a molecular weight of 221.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-amine. InChIKey: KWYFSDPLESBLQH-UHFFFAOYSA-N.
| Molecular formula | C10H16BN3O2 |
|---|---|
| Molecular weight | 221.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-amine |
| InChIKey | KWYFSDPLESBLQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CN=C2N |
Computed by PubChem (NCBI)