cas: 1219130-53-6 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2(1H)-one, 97% (CAS 1219130-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F465003-100MG |
| cas | 1219130-53-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1091.30 Pln | |
| Fluorochem | 5g | 4074.62 Pln | |
| Fluorochem | 10g | 7031.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-2-one (CAS 1219130-53-6) is a chemical compound with the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-2-one. InChIKey: ICKRHHRNOZOKML-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO3 |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-2-one |
| InChIKey | ICKRHHRNOZOKML-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC(=O)NC3=CC=C2 |
Computed by PubChem (NCBI)