CAS 2248157-58-4 is the registry number for 4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one (CAS 2248157-58-4) is a chemical compound with the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one. InChIKey: YDWXMSRZTFXPKE-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO3 |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one |
| InChIKey | YDWXMSRZTFXPKE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC(=O)C3=CC=CC=C23 |
Computed by PubChem (NCBI)