Products 2768872-08-6
CAS 2768872-08-6 is the registry number for 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-7-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-7-ol (CAS 2768872-08-6) is a chemical compound with the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-7-ol. InChIKey: HVGGLHLCDCTFEN-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO3 |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-7-ol |
| InChIKey | HVGGLHLCDCTFEN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2C=CC=N3)O |
Computed by PubChem (NCBI)