cas: 321385-58-4 — see every product listed under this CAS number, including other names
5-(4-(1H-Imidazol-1-yl)phenyl)-1H-pyrazole 95% (CAS 321385-58-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A427118-100mg |
| cas | 321385-58-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2356.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A427118 |
1-[4-(1H-pyrazol-5-yl)phenyl]imidazole (CAS 321385-58-4) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 1-[4-(1H-pyrazol-5-yl)phenyl]imidazole. InChIKey: UFXSELGOGDVWDO-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-[4-(1H-pyrazol-5-yl)phenyl]imidazole |
| InChIKey | UFXSELGOGDVWDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NN2)N3C=CN=C3 |
Computed by PubChem (NCBI)