cas: 321385-58-4 — see every product listed under this CAS number, including other names
5-[4-(1H-imidazol-1-yl)phenyl]-1H-pyrazole, 95%, 95% (CAS 321385-58-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZ34-100mg |
| cas | 321385-58-4 |
| size | 100mg |
| availability | 16g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 1826.00 Pln | |
| Chemat | 10g | 2286.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[4-(1H-pyrazol-5-yl)phenyl]imidazole (CAS 321385-58-4) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 1-[4-(1H-pyrazol-5-yl)phenyl]imidazole. InChIKey: UFXSELGOGDVWDO-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-[4-(1H-pyrazol-5-yl)phenyl]imidazole |
| InChIKey | UFXSELGOGDVWDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NN2)N3C=CN=C3 |
Computed by PubChem (NCBI)