cas: 1228689-61-9 — see every product listed under this CAS number, including other names
5-(4-Bromo-phenyl)-3-methyl-isoxazole-4-carboxylic acid methyl ester, 98% (CAS 1228689-61-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F070427-500MG |
| cas | 1228689-61-9 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 279.09 Pln | |
| Fluorochem | 1g | 424.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-(4-bromophenyl)-3-methyl-1,2-oxazole-4-carboxylate (CAS 1228689-61-9) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: methyl 5-(4-bromophenyl)-3-methyl-1,2-oxazole-4-carboxylate. InChIKey: YVWJQDKQALEQHO-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO3 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | methyl 5-(4-bromophenyl)-3-methyl-1,2-oxazole-4-carboxylate |
| InChIKey | YVWJQDKQALEQHO-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1C(=O)OC)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)