CAS 2186672-65-9 is the registry number for 3-Bromo-1-(4-ethoxyphenyl)-1h-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromo-1-(4-ethoxyphenyl)pyrrole-2,5-dione (CAS 2186672-65-9) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: 3-bromo-1-(4-ethoxyphenyl)pyrrole-2,5-dione. InChIKey: KREKWVBIXGJZSK-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO3 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | 3-bromo-1-(4-ethoxyphenyl)pyrrole-2,5-dione |
| InChIKey | KREKWVBIXGJZSK-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N2C(=O)C=C(C2=O)Br |
Computed by PubChem (NCBI)