CAS 23464-96-2 appears in our catalog under these names: 3-[5-(4-Bromophenyl)-1,3-oxazol-2-yl]propanoic acid, 95%, 3-[5-(4-Bromophenyl)-1,3-oxazol-2-yl]propanoic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 1g, 250mg, 5g.
3-[5-(4-bromophenyl)-1,3-oxazol-2-yl]propanoic acid (CAS 23464-96-2) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: 3-[5-(4-bromophenyl)-1,3-oxazol-2-yl]propanoic acid. InChIKey: JLFDJAGKPSZXGN-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO3 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | 3-[5-(4-bromophenyl)-1,3-oxazol-2-yl]propanoic acid |
| InChIKey | JLFDJAGKPSZXGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(O2)CCC(=O)O)Br |
Computed by PubChem (NCBI)