Products 391248-23-0
CAS 391248-23-0 appears in our catalog under these names: Ethyl 2-(4-bromophenyl)-1,3-oxazole-4-carboxylate, 95%, Ethyl 2-(4-bromophenyl)oxazole-4-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Ethyl 2-(4-bromophenyl)-1,3-oxazole-4-carboxylate (CAS 391248-23-0) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: ethyl 2-(4-bromophenyl)-1,3-oxazole-4-carboxylate. InChIKey: DPKLLURBSVFMKB-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO3 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | ethyl 2-(4-bromophenyl)-1,3-oxazole-4-carboxylate |
| InChIKey | DPKLLURBSVFMKB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=COC(=N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)