Products 1133116-21-8
CAS 1133116-21-8 is the registry number for Methyl 5-bromo-8-methyl-4-oxo-1,4-dihydroquinoline-2-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
Methyl 5-bromo-8-methyl-4-oxo-1H-quinoline-2-carboxylate (CAS 1133116-21-8) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: methyl 5-bromo-8-methyl-4-oxo-1H-quinoline-2-carboxylate. InChIKey: WWNYNLAVZQJOAI-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO3 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | methyl 5-bromo-8-methyl-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | WWNYNLAVZQJOAI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Br)C(=O)C=C(N2)C(=O)OC |
Computed by PubChem (NCBI)