5-(4-Bromophenyl)furan-2-carboxylic acid
cas: 52938-96-2 — see every product listed under this CAS number, including other names
5-(4-Bromophenyl)furan-2-carboxylic acid (CAS 52938-96-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F663155-100MG |
| cas | 52938-96-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 500mg | 508.17 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 2627.22 Pln |
properties
| delivery time | 3-4 weeks |
|---|
5-(4-bromophenyl)furan-2-carboxylic acid (CAS 52938-96-2) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 5-(4-bromophenyl)furan-2-carboxylic acid. InChIKey: MYPDSPQSFHXXTF-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 5-(4-bromophenyl)furan-2-carboxylic acid |
| InChIKey | MYPDSPQSFHXXTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C(=O)O)Br |
Computed by PubChem (NCBI)