cas: 52938-96-2 — see every product listed under this CAS number, including other names
5-(4-Bromophenyl)-2-furoic acid, 99%(LC-MS),RG, 99%(LC-MS),RG (CAS 52938-96-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114M66-100mg |
| cas | 52938-96-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 500mg | 323.60 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1600.40 Pln | |
| Chemat | 25g | 7446.80 Pln |
| purity | 99%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
5-(4-bromophenyl)furan-2-carboxylic acid (CAS 52938-96-2) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 5-(4-bromophenyl)furan-2-carboxylic acid. InChIKey: MYPDSPQSFHXXTF-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 5-(4-bromophenyl)furan-2-carboxylic acid |
| InChIKey | MYPDSPQSFHXXTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C(=O)O)Br |
Computed by PubChem (NCBI)