cas: 680617-88-3 — see every product listed under this CAS number, including other names
5-(4-Chlorobenzamido)-2-ethoxybenzene-1-sulfonyl chloride 95% (CAS 680617-88-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A396856-100mg |
| cas | 680617-88-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 921.06 Pln | |
| Ambeed | 1g | 1644.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A396856 |
5-[(4-chlorobenzoyl)amino]-2-ethoxybenzenesulfonyl chloride (CAS 680617-88-3) is a chemical compound with the molecular formula C15H13Cl2NO4S and a molecular weight of 374.2 g/mol. IUPAC name: 5-[(4-chlorobenzoyl)amino]-2-ethoxybenzenesulfonyl chloride. InChIKey: XSDRDPBHLIDKQA-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO4S |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | 5-[(4-chlorobenzoyl)amino]-2-ethoxybenzenesulfonyl chloride |
| InChIKey | XSDRDPBHLIDKQA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)