Products 884987-88-6

CAS 884987-88-6 is the registry number for N-(2,5-Dichlorophenyl)-n-[(4-methylphenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetic acid (CAS 884987-88-6) is a chemical compound with the molecular formula C15H13Cl2NO4S and a molecular weight of 374.2 g/mol. IUPAC name: 2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetic acid. InChIKey: ONQRGUANVKOFAP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13Cl2NO4S
Molecular weight374.2 g/mol
IUPAC name2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetic acid
InChIKeyONQRGUANVKOFAP-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=C(C=CC(=C2)Cl)Cl

Computed by PubChem (NCBI)