Products 1207326-90-6

CAS 1207326-90-6 is the registry number for 4-([(3,5-Dichlorophenyl)(methylsulfonyl)amino]methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-[(3,5-dichloro-N-methylsulfonylanilino)methyl]benzoic acid (CAS 1207326-90-6) is a chemical compound with the molecular formula C15H13Cl2NO4S and a molecular weight of 374.2 g/mol. IUPAC name: 4-[(3,5-dichloro-N-methylsulfonylanilino)methyl]benzoic acid. InChIKey: QGSLEJHKHPYHRD-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13Cl2NO4S
Molecular weight374.2 g/mol
IUPAC name4-[(3,5-dichloro-N-methylsulfonylanilino)methyl]benzoic acid
InChIKeyQGSLEJHKHPYHRD-UHFFFAOYSA-N
SMILESCS(=O)(=O)N(CC1=CC=C(C=C1)C(=O)O)C2=CC(=CC(=C2)Cl)Cl

Computed by PubChem (NCBI)