CAS 884987-04-6 is the registry number for N-(3,4-Dichlorophenyl)-n-[(4-methylphenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3,4-dichloro-N-(4-methylphenyl)sulfonylanilino)acetic acid (CAS 884987-04-6) is a chemical compound with the molecular formula C15H13Cl2NO4S and a molecular weight of 374.2 g/mol. IUPAC name: 2-(3,4-dichloro-N-(4-methylphenyl)sulfonylanilino)acetic acid. InChIKey: RYGDBHFLBZXBNX-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO4S |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | 2-(3,4-dichloro-N-(4-methylphenyl)sulfonylanilino)acetic acid |
| InChIKey | RYGDBHFLBZXBNX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)