Products 952930-90-4

CAS 952930-90-4 is the registry number for 4-[(2,6-Dichlorobenzyl)(methylsulfonyl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-[(2,6-dichlorophenyl)methyl-methylsulfonylamino]benzoic acid (CAS 952930-90-4) is a chemical compound with the molecular formula C15H13Cl2NO4S and a molecular weight of 374.2 g/mol. IUPAC name: 4-[(2,6-dichlorophenyl)methyl-methylsulfonylamino]benzoic acid. InChIKey: QAZNMAKWNHTODH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13Cl2NO4S
Molecular weight374.2 g/mol
IUPAC name4-[(2,6-dichlorophenyl)methyl-methylsulfonylamino]benzoic acid
InChIKeyQAZNMAKWNHTODH-UHFFFAOYSA-N
SMILESCS(=O)(=O)N(CC1=C(C=CC=C1Cl)Cl)C2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)