cas: 187999-33-3 — see every product listed under this CAS number, including other names
5-(4-Chlorophenyl)nicotinic acid, 97% (CAS 187999-33-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | YA-6689-10g |
| cas | 187999-33-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 685.19 Pln | |
| Fluorochem | 5g | 1893.10 Pln | |
| Fluorochem | 10g | 3106.22 Pln | |
| Fluorochem | 25g | 7687.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-(4-chlorophenyl)pyridine-3-carboxylic acid (CAS 187999-33-3) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 5-(4-chlorophenyl)pyridine-3-carboxylic acid. InChIKey: BYZIYNPOAGZGJW-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 5-(4-chlorophenyl)pyridine-3-carboxylic acid |
| InChIKey | BYZIYNPOAGZGJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CN=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)