cas: 187999-33-3 — see every product listed under this CAS number, including other names
5-(4-Chlorophenyl)nicotinic acid, 98% (CAS 187999-33-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A153133-25g |
| cas | 187999-33-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 12334.84 Pln | |
| AmBeed | 250mg | 375.97 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(4-chlorophenyl)pyridine-3-carboxylic acid (CAS 187999-33-3) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 5-(4-chlorophenyl)pyridine-3-carboxylic acid. InChIKey: BYZIYNPOAGZGJW-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 5-(4-chlorophenyl)pyridine-3-carboxylic acid |
| InChIKey | BYZIYNPOAGZGJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CN=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)