cas: 347867-75-8 — see every product listed under this CAS number, including other names
5-(4-Fluorophenoxy)-N-Valeric Acid, ≥98%, ≥98% (CAS 347867-75-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114M6U-250mg |
| cas | 347867-75-8 |
| size | 250mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 1293.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
5-(4-fluorophenoxy)pentanoic acid (CAS 347867-75-8) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: 5-(4-fluorophenoxy)pentanoic acid. InChIKey: SNUHBWJBUYDESY-UHFFFAOYSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 5-(4-fluorophenoxy)pentanoic acid |
| InChIKey | SNUHBWJBUYDESY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCCCC(=O)O)F |
Computed by PubChem (NCBI)