cas: 347867-75-8 — see every product listed under this CAS number, including other names
5-(4-Fluorophenoxy)valeric Acid, >98.0%(T)(GC) (CAS 347867-75-8) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0410-5G |
| cas | 347867-75-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 1544.35 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T)(GC) |
5-(4-fluorophenoxy)pentanoic acid (CAS 347867-75-8) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: 5-(4-fluorophenoxy)pentanoic acid. InChIKey: SNUHBWJBUYDESY-UHFFFAOYSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 5-(4-fluorophenoxy)pentanoic acid |
| InChIKey | SNUHBWJBUYDESY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCCCC(=O)O)F |
Computed by PubChem (NCBI)