Products 870704-22-6
CAS 870704-22-6 appears in our catalog under these names: 2-(4-Fluorophenyl)-1H-imidazole-4-carboxylic acid, 5-(4-Fluorophenyl)-1H-pyrazole-3-carboxylic acid, 98%, 98%, 3-(4-Fluoro-phenyl)-1H-pyrazole-5-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2g, 100mg, 250mg, 1g, 5g, 10g, 25g.
3-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid (CAS 870704-22-6) is a chemical compound with the molecular formula C10H7FN2O2 and a molecular weight of 206.17 g/mol. IUPAC name: 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: FDNYHBASQZFVBL-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | FDNYHBASQZFVBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
3-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid, 5-(4-fluorophenyl)-1H-pyrazole-3-carboxylic acid, 5-(4-Fluoro-phenyl)-2H-pyrazole-3-carboxylic acid, cid_940540, 5-(4-fluoro-phenyl)-2 h-pyrazole-3-carboxylic acid, 3-(4-fluorophenyl)pyrazole-5-carboxylic acid, CINNAMALDEHYDEOXIME, 5-(4-fluoro-phenyl)-1H-pyrazole-3-carboxylic acid, orb3029748, Fr21244