Products 618383-44-1
CAS 618383-44-1 appears in our catalog under these names: 5-(4-Fluorophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 3-(4-Fluorophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 3-(4-Fluorophenyl)-1H-pyrazole-4-carboxylic acid 95+%, 3-(4-Fluorophenyl)-1H-pyrazole-4-carboxylic acid, 95+%, 95+%, 3-(4-fluorophenyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
5-(4-fluorophenyl)-1H-pyrazole-4-carboxylic acid (CAS 618383-44-1) is a chemical compound with the molecular formula C10H7FN2O2 and a molecular weight of 206.17 g/mol. IUPAC name: 5-(4-fluorophenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: PVFRXBPKNHHXFE-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1H-pyrazole-4-carboxylic acid |
| InChIKey | PVFRXBPKNHHXFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NN2)C(=O)O)F |
Computed by PubChem (NCBI)