CAS 1188375-17-8 appears in our catalog under these names: 3-(3-Fluorophenyl)-1h-pyrazole-5-carboxylic acid, 90%, 3-(3-Fluorophenyl)-1H-pyrazole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
3-(3-fluorophenyl)-1H-pyrazole-5-carboxylic acid (CAS 1188375-17-8) is a chemical compound with the molecular formula C10H7FN2O2 and a molecular weight of 206.17 g/mol. IUPAC name: 3-(3-fluorophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: FMJUQKZHSLNVNW-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | FMJUQKZHSLNVNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)